| Name | Basic Red 1:1 |
| Synonyms | BASIC RED Rohdamine 6GD 3,6-bis(ethylamino)-9-[2-(methoxycarbonyl)phenyl]-2,7-dimethyl-xanthyliuch 3,6-Bis(ethylamino)-9-(2-(methoxycarbonyl)phenyl)-2,7-dimethylxanthylium chloride Xanthylium, 3,6-bis(ethylamino)-9-(2-(methoxycarbonyl)phenyl)-2,7-dimethyl-, chloride methyl 2-[2,8-bis(ethylamino)-3,7-dimethyl-pyrano[6,5-b]chromen-10-ium-5-yl]benzoate chloride [9-(2-carbomethoxyphenyl)-6-(ethylamino)-2,7-dimethyl-xanthen-3-ylidene]-ethyl-ammonium chloride ethyl-[6-(ethylamino)-9-(2-methoxycarbonylphenyl)-2,7-dimethylxanthen-3-ylidene]azanium chloride ethyl-[6-(ethylamino)-9-(2-methoxycarbonylphenyl)-2,7-dimethyl-xanthen-3-ylidene]azanium chloride |
| CAS | 3068-39-1 |
| EINECS | 221-326-1 |
| InChI | InChI=1/C26H28N2O4.ClH/c1-6-27-21-14-22-19(12-15(21)3)23(17-10-8-9-11-18(17)25(29)30-5)20-13-16(4)24(28-7-2)32-26(20)31-22;/h8-14,27-28H,6-7H2,1-5H3;1H/q+1;/p-1 |
| Molecular Formula | C27H29ClN2O3 |
| Molar Mass | 464.99 |
| Density | 1.27[at 20℃] |
| Water Solubility | 18.9g/L at 20℃ |
| Vapor Presure | 0Pa at 25℃ |
| Appearance | powder to crystal |
| Color | Orange to Brown to Dark purple |
| Maximum wavelength(λmax) | ['525nm(H2O)(lit.)'] |
| Storage Condition | Room Temprature |
| Use | Pigments for the manufacture of advanced inks |
| UN IDs | UN 2811 6.1/PG II |
| Hazard Class | 6.1 |
| Packing Group | II |
| LogP | 1.7 at 20℃ |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| use | pigment for making advanced ink |